C10H13ClN4O3 — CID 90686026
(2S,3S,4R)-2-azido-5-(2-chloro-3-pyridinyl)pentane-1,3,4-triol (PubChem CID 90686026) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is (2S,3S,4R)-2-azido-5-(2-chloro-3-pyridinyl)pentane-1,3,4-triol.
| Compound Name | (2S,3S,4R)-2-azido-5-(2-chloro-3-pyridinyl)pentane-1,3,4-triol |
|---|---|
| PubChem CID | 90686026 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (2S,3S,4R)-2-azido-5-(2-chloro-3-pyridinyl)pentane-1,3,4-triol |
| SMILES | [N-]=[N+]=N[C@@H](CO)[C@H](O)[C@H](O)Cc1cccnc1Cl |
| InChI | InChI=1S/C10H13ClN4O3/c11-10-6(2-1-3-13-10)4-8(17)9(18)7(5-16)14-15-12/h1-3,7-9,16-18H,4-5H2/t7-,8+,9-/m0/s1 |
| InChIKey | PYOVVKDDPVIYAU-YIZRAAEISA-N |
| XLogP | 0.67 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|