C19H29N5O2 — CID 90686255
3-[2-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]pyrimidin-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 90686255) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-[2-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]pyrimidin-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[2-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]pyrimidin-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 90686255 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 3-[2-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]amino]pyrimidin-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1cnc(N[C@@H]2CCCN(CC3CCCCC3)C2)nc1)NO |
| InChI | InChI=1S/C19H29N5O2/c25-18(23-26)9-8-16-11-20-19(21-12-16)22-17-7-4-10-24(14-17)13-15-5-2-1-3-6-15/h8-9,11-12,15,17,26H,1-7,10,13-14H2,(H,23,25)(H,20,21,22)/t17-/m1/s1 |
| InChIKey | GOQCAORLMGVYNJ-QGZVFWFLSA-N |
| XLogP | 2.45 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|