About [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate
[[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate (PubChem CID 90686258) has the molecular formula C21H19N3O6
and a molecular weight of 409.40 g/mol. Its IUPAC name is [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate.
Molecular Properties
| Compound Name | [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate |
| PubChem CID | 90686258 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate |
| SMILES | CNC(=O)ON=C(OCC1c2ccccc2-c2ccccc21)On1c(O)ccc1O |
| InChI | InChI=1S/C21H19N3O6/c1-22-20(27)29-23-21(30-24-18(25)10-11-19(24)26)28-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-11,17,25-26H,12H2,1H3,(H,22,27) |
| InChIKey | GERHTBKZBZMQOS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate?
The IUPAC name of [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate (CID 90686258) is [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate.
What is the SMILES notation for [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate?
The canonical SMILES for [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate is CNC(=O)ON=C(OCC1c2ccccc2-c2ccccc21)On1c(O)ccc1O.
What is the InChIKey of [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate?
The InChIKey is GERHTBKZBZMQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O6/c1-22-20(27)29-23-21(30-24-18(25)10-11-19(24)26)28-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-11,17,25-26H,12H2,1H3,(H,22,27).
What are the key properties of [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate?
[[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate has a molecular weight of 409.40 g/mol, XLogP of 2.78, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2,5-dihydroxypyrrol-1-yl)oxy-(9H-fluoren-9-ylmethoxy)methylidene]amino] N-methylcarbamate is sourced from PubChem (CID 90686258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).