About (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine
(E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine (PubChem CID 90686552) has the molecular formula C9H14F3NO
and a molecular weight of 209.21 g/mol. Its IUPAC name is (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine |
| PubChem CID | 90686552 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine |
| SMILES | CCC/C=C(\C=N\C)OCC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO/c1-3-4-5-8(6-13-2)14-7-9(10,11)12/h5-6H,3-4,7H2,1-2H3/b8-5+,13-6+ |
| InChIKey | GNHMWEULWQHXPS-NYNNJMMMSA-N |
| XLogP | 2.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine?
The IUPAC name of (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine (CID 90686552) is (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine.
What is the SMILES notation for (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine?
The canonical SMILES for (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine is CCC/C=C(\C=N\C)OCC(F)(F)F.
What is the InChIKey of (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine?
The InChIKey is GNHMWEULWQHXPS-NYNNJMMMSA-N. The full InChI is InChI=1S/C9H14F3NO/c1-3-4-5-8(6-13-2)14-7-9(10,11)12/h5-6H,3-4,7H2,1-2H3/b8-5+,13-6+.
What are the key properties of (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine?
(E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine has a molecular weight of 209.21 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methyl-2-(2,2,2-trifluoroethoxy)hex-2-en-1-imine is sourced from PubChem (CID 90686552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).