About 5,6-dimethoxy-2,2-dimethylbenzimidazole
5,6-dimethoxy-2,2-dimethylbenzimidazole (PubChem CID 90686624) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 5,6-dimethoxy-2,2-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 5,6-dimethoxy-2,2-dimethylbenzimidazole |
| PubChem CID | 90686624 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5,6-dimethoxy-2,2-dimethylbenzimidazole |
| SMILES | COc1cc2c(cc1OC)=NC(C)(C)N=2 |
| InChI | InChI=1S/C11H14N2O2/c1-11(2)12-7-5-9(14-3)10(15-4)6-8(7)13-11/h5-6H,1-4H3 |
| InChIKey | QLQXSTRXGBYVIL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethoxy-2,2-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-2,2-dimethylbenzimidazole?
The IUPAC name of 5,6-dimethoxy-2,2-dimethylbenzimidazole (CID 90686624) is 5,6-dimethoxy-2,2-dimethylbenzimidazole.
What is the SMILES notation for 5,6-dimethoxy-2,2-dimethylbenzimidazole?
The canonical SMILES for 5,6-dimethoxy-2,2-dimethylbenzimidazole is COc1cc2c(cc1OC)=NC(C)(C)N=2.
What is the InChIKey of 5,6-dimethoxy-2,2-dimethylbenzimidazole?
The InChIKey is QLQXSTRXGBYVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-11(2)12-7-5-9(14-3)10(15-4)6-8(7)13-11/h5-6H,1-4H3.
What are the key properties of 5,6-dimethoxy-2,2-dimethylbenzimidazole?
5,6-dimethoxy-2,2-dimethylbenzimidazole has a molecular weight of 206.24 g/mol, XLogP of 0.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-2,2-dimethylbenzimidazole is sourced from PubChem (CID 90686624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).