C23H28N4O11S — CID 90686895
2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]-2,2-dihydroxyacetamide (PubChem CID 90686895) has the molecular formula C23H28N4O11S and a molecular weight of 568.56 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]-2,2-dihydroxyacetamide.
| Compound Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]-2,2-dihydroxyacetamide |
|---|---|
| PubChem CID | 90686895 |
| Molecular Formula | C23H28N4O11S |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[1,1-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]phenyl]-2,2-dihydroxyacetamide |
| SMILES | COC(CNCC(O)(O)c1ccc(NC(=O)C(O)(O)c2nc(N)sc2O)cc1)c1c(C)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C23H28N4O11S/c1-9-13(15(29)17(31)16(30)14(9)28)12(38-2)7-25-8-22(34,35)10-3-5-11(6-4-10)26-20(33)23(36,37)18-19(32)39-21(24)27-18/h3-6,12,25,28-32,34-37H,7-8H2,1-2H3,(H2,24,27)(H,26,33) |
| InChIKey | AMAYZTIMKMPPFF-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 271.34 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|