About methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate
methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate (PubChem CID 90687127) has the molecular formula C9H13NS2
and a molecular weight of 199.34 g/mol. Its IUPAC name is methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate.
Molecular Properties
| Compound Name | methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate |
| PubChem CID | 90687127 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate |
| SMILES | C/C=N/C=C\C(C)=CC(=S)SC |
| InChI | InChI=1S/C9H13NS2/c1-4-10-6-5-8(2)7-9(11)12-3/h4-7H,1-3H3/b6-5-,8-7?,10-4+ |
| InChIKey | HKCJIECLIXHJEI-NLVUVKERSA-N |
| XLogP | 3.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate?
The IUPAC name of methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate (CID 90687127) is methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate.
What is the SMILES notation for methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate?
The canonical SMILES for methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate is C/C=N/C=C\C(C)=CC(=S)SC.
What is the InChIKey of methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate?
The InChIKey is HKCJIECLIXHJEI-NLVUVKERSA-N. The full InChI is InChI=1S/C9H13NS2/c1-4-10-6-5-8(2)7-9(11)12-3/h4-7H,1-3H3/b6-5-,8-7?,10-4+.
What are the key properties of methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate?
methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate has a molecular weight of 199.34 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4Z)-5-(ethylideneamino)-3-methylpenta-2,4-dienedithioate is sourced from PubChem (CID 90687127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).