C13H13NO2 — CID 90687438
(1E,4Z,7Z,9Z)-3-iminocyclododeca-1,4,7,9,11-pentaene-1-carboxylic acid (PubChem CID 90687438) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (1E,4Z,7Z,9Z)-3-iminocyclododeca-1,4,7,9,11-pentaene-1-carboxylic acid.
| Compound Name | (1E,4Z,7Z,9Z)-3-iminocyclododeca-1,4,7,9,11-pentaene-1-carboxylic acid |
|---|---|
| PubChem CID | 90687438 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (1E,4Z,7Z,9Z)-3-iminocyclododeca-1,4,7,9,11-pentaene-1-carboxylic acid |
| SMILES | [H]/N=C1\C=C/C/C=C\C=C/C=C/C(C(=O)O)=C\1 |
| InChI | InChI=1S/C13H13NO2/c14-12-9-7-5-3-1-2-4-6-8-11(10-12)13(15)16/h1-4,6-10,14H,5H2,(H,15,16)/b3-1-,4-2-,8-6?,9-7-,11-10+,14-12+ |
| InChIKey | BWDCJLVIRPISSA-KDUHALDESA-N |
| XLogP | 2.65 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|