About 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide
5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide (PubChem CID 90687569) has the molecular formula C14H9F3N4O3S
and a molecular weight of 370.31 g/mol. Its IUPAC name is 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide |
| PubChem CID | 90687569 |
| Molecular Formula | C14H9F3N4O3S |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide |
| SMILES | Nc1onc(-c2nccs2)c1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H9F3N4O3S/c15-14(16,17)23-8-3-1-7(2-4-8)20-12(22)9-10(21-24-11(9)18)13-19-5-6-25-13/h1-6H,18H2,(H,20,22) |
| InChIKey | FLIZNYMBRHOCBP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide?
The IUPAC name of 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide (CID 90687569) is 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide?
The canonical SMILES for 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide is Nc1onc(-c2nccs2)c1C(=O)Nc1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide?
The InChIKey is FLIZNYMBRHOCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F3N4O3S/c15-14(16,17)23-8-3-1-7(2-4-8)20-12(22)9-10(21-24-11(9)18)13-19-5-6-25-13/h1-6H,18H2,(H,20,22).
What are the key properties of 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide?
5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide has a molecular weight of 370.31 g/mol, XLogP of 3.53, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(1,3-thiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 90687569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).