C19H29BrN4O2 — CID 90688005
5-bromo-1-(1-cyclopropyl-2-methoxyethyl)-4-methyl-3-[(2,5,6-trimethyl-3-pyridinyl)amino]piperazin-2-one (PubChem CID 90688005) has the molecular formula C19H29BrN4O2 and a molecular weight of 425.37 g/mol. Its IUPAC name is 5-bromo-1-(1-cyclopropyl-2-methoxyethyl)-4-methyl-3-[(2,5,6-trimethyl-3-pyridinyl)amino]piperazin-2-one.
| Compound Name | 5-bromo-1-(1-cyclopropyl-2-methoxyethyl)-4-methyl-3-[(2,5,6-trimethyl-3-pyridinyl)amino]piperazin-2-one |
|---|---|
| PubChem CID | 90688005 |
| Molecular Formula | C19H29BrN4O2 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 5-bromo-1-(1-cyclopropyl-2-methoxyethyl)-4-methyl-3-[(2,5,6-trimethyl-3-pyridinyl)amino]piperazin-2-one |
| SMILES | COCC(C1CC1)N1CC(Br)N(C)C(Nc2cc(C)c(C)nc2C)C1=O |
| InChI | InChI=1S/C19H29BrN4O2/c1-11-8-15(13(3)21-12(11)2)22-18-19(25)24(9-17(20)23(18)4)16(10-26-5)14-6-7-14/h8,14,16-18,22H,6-7,9-10H2,1-5H3 |
| InChIKey | FILNJLLVZKNZGS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|