C14H22N2O8 — CID 90688224
(2,5-dihydroxypyrrol-1-yl) 4-[2-(2-methoxyethoxycarbonylamino)ethoxy]butanoate (PubChem CID 90688224) has the molecular formula C14H22N2O8 and a molecular weight of 346.34 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[2-(2-methoxyethoxycarbonylamino)ethoxy]butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-(2-methoxyethoxycarbonylamino)ethoxy]butanoate |
|---|---|
| PubChem CID | 90688224 |
| Molecular Formula | C14H22N2O8 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-(2-methoxyethoxycarbonylamino)ethoxy]butanoate |
| SMILES | COCCOC(=O)NCCOCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C14H22N2O8/c1-21-9-10-23-14(20)15-6-8-22-7-2-3-13(19)24-16-11(17)4-5-12(16)18/h4-5,17-18H,2-3,6-10H2,1H3,(H,15,20) |
| InChIKey | KONLTTLTHIHPAW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|