C16H14N2O2 — CID 90688423
5-methyl-5-phenyl-2,3-diazabicyclo[5.3.1]undeca-1(10),7(11),8-triene-4,6-dione (PubChem CID 90688423) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-methyl-5-phenyl-2,3-diazabicyclo[5.3.1]undeca-1(10),7(11),8-triene-4,6-dione.
| Compound Name | 5-methyl-5-phenyl-2,3-diazabicyclo[5.3.1]undeca-1(10),7(11),8-triene-4,6-dione |
|---|---|
| PubChem CID | 90688423 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 5-methyl-5-phenyl-2,3-diazabicyclo[5.3.1]undeca-1(10),7(11),8-triene-4,6-dione |
| SMILES | CC1(c2ccccc2)C(=O)NNc2cccc(c2)C1=O |
| InChI | InChI=1S/C16H14N2O2/c1-16(12-7-3-2-4-8-12)14(19)11-6-5-9-13(10-11)17-18-15(16)20/h2-10,17H,1H3,(H,18,20) |
| InChIKey | HBJBJIYUSTWYFD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|