About 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane
3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane (PubChem CID 90688913) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane |
| PubChem CID | 90688913 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane |
| SMILES | CC.CC.c1cnc2c(c1)CCCO2 |
| InChI | InChI=1S/C8H9NO.2C2H6/c1-3-7-4-2-6-10-8(7)9-5-1;2*1-2/h1,3,5H,2,4,6H2;2*1-2H3 |
| InChIKey | PJTTTYUSEXQHSG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane?
The IUPAC name of 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane (CID 90688913) is 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane.
What is the SMILES notation for 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane?
The canonical SMILES for 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane is CC.CC.c1cnc2c(c1)CCCO2.
What is the InChIKey of 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane?
The InChIKey is PJTTTYUSEXQHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.2C2H6/c1-3-7-4-2-6-10-8(7)9-5-1;2*1-2/h1,3,5H,2,4,6H2;2*1-2H3.
What are the key properties of 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane?
3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane has a molecular weight of 195.31 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrano[2,3-b]pyridine;ethane is sourced from PubChem (CID 90688913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).