C22H26N4O12S — CID 90688922
2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[1,1,2,2-tetrahydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide (PubChem CID 90688922) has the molecular formula C22H26N4O12S and a molecular weight of 570.53 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[1,1,2,2-tetrahydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[1,1,2,2-tetrahydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90688922 |
| Molecular Formula | C22H26N4O12S |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[1,1,2,2-tetrahydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide |
| SMILES | COC(CNC(O)(O)C(O)(O)c1c(O)c(O)c(NC(=O)C(O)(O)c2csc(N)n2)c(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O12S/c1-38-10(9-5-3-2-4-6-9)7-24-22(36,37)21(34,35)12-14(27)16(29)13(17(30)15(12)28)26-18(31)20(32,33)11-8-39-19(23)25-11/h2-6,8,10,24,27-30,32-37H,7H2,1H3,(H2,23,25)(H,26,31) |
| InChIKey | GAQNSPCMEIXWGJ-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 291.57 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|