C11H4ClF5N4S — CID 90688995
2-(2-chloropyrimidin-4-yl)-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 90688995) has the molecular formula C11H4ClF5N4S and a molecular weight of 354.69 g/mol. Its IUPAC name is 2-(2-chloropyrimidin-4-yl)-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-(2-chloropyrimidin-4-yl)-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 90688995 |
| Molecular Formula | C11H4ClF5N4S |
| Molecular Weight | 354.69 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-(2-chloropyrimidin-4-yl)-2-[4-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | N#CC(c1ccnc(Cl)n1)c1nc(C(F)(F)C(F)(F)F)cs1 |
| InChI | InChI=1S/C11H4ClF5N4S/c12-9-19-2-1-6(20-9)5(3-18)8-21-7(4-22-8)10(13,14)11(15,16)17/h1-2,4-5H |
| InChIKey | BTNNZIBRBOOUBB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|