C38H56N3O11P — CID 90689607
2-[[N'-bis[2-methyl-1-(3-phenylpropoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-2-cyclohexylacetic acid (PubChem CID 90689607) has the molecular formula C38H56N3O11P and a molecular weight of 761.85 g/mol. Its IUPAC name is 2-[[N'-bis[2-methyl-1-(3-phenylpropoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-2-cyclohexylacetic acid.
| Compound Name | 2-[[N'-bis[2-methyl-1-(3-phenylpropoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-2-cyclohexylacetic acid |
|---|---|
| PubChem CID | 90689607 |
| Molecular Formula | C38H56N3O11P |
| Molecular Weight | 761.85 g/mol |
| Exact Mass | 761.37 |
| IUPAC Name | 2-[[N'-bis[2-methyl-1-(3-phenylpropoxycarbonyloxy)propoxy]phosphorylcarbamimidoyl]-methylamino]-2-cyclohexylacetic acid |
| SMILES | CC(C)C(OC(=O)OCCCc1ccccc1)OP(=O)(N=C(N)N(C)C(C(=O)O)C1CCCCC1)OC(OC(=O)OCCCc1ccccc1)C(C)C |
| InChI | InChI=1S/C38H56N3O11P/c1-27(2)34(49-37(44)47-25-15-21-29-17-9-6-10-18-29)51-53(46,40-36(39)41(5)32(33(42)43)31-23-13-8-14-24-31)52-35(28(3)4)50-38(45)48-26-16-22-30-19-11-7-12-20-30/h6-7,9-12,17-20,27-28,31-32,34-35H,8,13-16,21-26H2,1-5H3,(H,42,43)(H2,39,40,46) |
| InChIKey | LSFHAJKBEQHLKG-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.85 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|