About ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene
ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 90689675) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 90689675 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC.CN1C2C=CC=CC21 |
| InChI | InChI=1S/C7H9N.C2H6/c1-8-6-4-2-3-5-7(6)8;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | RBAZGESRCOCQKW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene (CID 90689675) is ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene is CC.CN1C2C=CC=CC21.
What is the InChIKey of ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is RBAZGESRCOCQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C2H6/c1-8-6-4-2-3-5-7(6)8;1-2/h2-7H,1H3;1-2H3.
What are the key properties of ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene?
ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 137.23 g/mol, XLogP of 1.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-7-azabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 90689675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).