C21H18FN3O3 — CID 90690674
2-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]acetamide (PubChem CID 90690674) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]acetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 90690674 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-8,9-dihydroxy-7-methylpyrrolo[3,4-g]quinolin-5-yl]acetamide |
| SMILES | Cn1cc2c(CC(N)=O)c3cc(Cc4ccc(F)cc4)cnc3c(O)c2c1O |
| InChI | InChI=1S/C21H18FN3O3/c1-25-10-16-14(8-17(23)26)15-7-12(6-11-2-4-13(22)5-3-11)9-24-19(15)20(27)18(16)21(25)28/h2-5,7,9-10,27-28H,6,8H2,1H3,(H2,23,26) |
| InChIKey | BYHKHTCJELBGLW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|