About [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate
[3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate (PubChem CID 90690719) has the molecular formula C31H22F2N4O2
and a molecular weight of 520.54 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate.
Molecular Properties
| Compound Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate |
| PubChem CID | 90690719 |
| Molecular Formula | C31H22F2N4O2 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)c(F)c1)OCc1cc(Nc2c3ccccc3nc3ccccc23)cc(-c2ccc[nH]2)c1 |
| InChI | InChI=1S/C31H22F2N4O2/c32-25-12-11-21(17-26(25)33)36-31(38)39-18-19-14-20(27-10-5-13-34-27)16-22(15-19)35-30-23-6-1-3-8-28(23)37-29-9-4-2-7-24(29)30/h1-17,34H,18H2,(H,35,37)(H,36,38) |
| InChIKey | WIWBEHGVSNAVSB-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate?
The IUPAC name of [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate (CID 90690719) is [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate.
What is the SMILES notation for [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate?
The canonical SMILES for [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate is O=C(Nc1ccc(F)c(F)c1)OCc1cc(Nc2c3ccccc3nc3ccccc23)cc(-c2ccc[nH]2)c1.
What is the InChIKey of [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate?
The InChIKey is WIWBEHGVSNAVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22F2N4O2/c32-25-12-11-21(17-26(25)33)36-31(38)39-18-19-14-20(27-10-5-13-34-27)16-22(15-19)35-30-23-6-1-3-8-28(23)37-29-9-4-2-7-24(29)30/h1-17,34H,18H2,(H,35,37)(H,36,38).
What are the key properties of [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate?
[3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate has a molecular weight of 520.54 g/mol, XLogP of 8.15, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(acridin-9-ylamino)-5-(1H-pyrrol-2-yl)phenyl]methyl N-(3,4-difluorophenyl)carbamate is sourced from PubChem (CID 90690719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).