C24H41N — CID 90690760
9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3-azaspiro[5.5]undecane (PubChem CID 90690760) has the molecular formula C24H41N and a molecular weight of 343.60 g/mol. Its IUPAC name is 9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3-azaspiro[5.5]undecane.
| Compound Name | 9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 90690760 |
| Molecular Formula | C24H41N |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | 9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3-azaspiro[5.5]undecane |
| SMILES | C=CC=CC=C(C)C(C)CC(C)(C)N1CCC2(CCC(C)CC2)CC1 |
| InChI | InChI=1S/C24H41N/c1-7-8-9-10-21(3)22(4)19-23(5,6)25-17-15-24(16-18-25)13-11-20(2)12-14-24/h7-10,20,22H,1,11-19H2,2-6H3 |
| InChIKey | HSZAVNQZJKKJOV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|