C22H29F2NO5S — CID 90691065
7-[(1R,2R,5S)-2-[(3R)-4-(3,5-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]hept-5-enoic acid (PubChem CID 90691065) has the molecular formula C22H29F2NO5S and a molecular weight of 457.54 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3R)-4-(3,5-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3R)-4-(3,5-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90691065 |
| Molecular Formula | C22H29F2NO5S |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3R)-4-(3,5-difluorophenyl)sulfanyl-3-hydroxybutyl]-5-hydroxy-3-nitrosocyclopentyl]hept-5-enoic acid |
| SMILES | O=NC1C[C@H](O)[C@H](CC=CCCCC(=O)O)[C@H]1CC[C@@H](O)CSc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H29F2NO5S/c23-14-9-15(24)11-17(10-14)31-13-16(26)7-8-18-19(21(27)12-20(18)25-30)5-3-1-2-4-6-22(28)29/h1,3,9-11,16,18-21,26-27H,2,4-8,12-13H2,(H,28,29)/t16-,18-,19-,20?,21+/m1/s1 |
| InChIKey | SXHRPGWMANQZJF-AYTNOTDUSA-N |
| XLogP | 4.53 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|