About 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine
5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine (PubChem CID 90691242) has the molecular formula C14H15N
and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine |
| PubChem CID | 90691242 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine |
| SMILES | C#CC1CC=CC=C1C1=CN=C(C)CC1 |
| InChI | InChI=1S/C14H15N/c1-3-12-6-4-5-7-14(12)13-9-8-11(2)15-10-13/h1,4-5,7,10,12H,6,8-9H2,2H3 |
| InChIKey | CTVSBDJTGNDXIO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine?
The IUPAC name of 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine (CID 90691242) is 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine.
What is the SMILES notation for 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine?
The canonical SMILES for 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine is C#CC1CC=CC=C1C1=CN=C(C)CC1.
What is the InChIKey of 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine?
The InChIKey is CTVSBDJTGNDXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N/c1-3-12-6-4-5-7-14(12)13-9-8-11(2)15-10-13/h1,4-5,7,10,12H,6,8-9H2,2H3.
What are the key properties of 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine?
5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine has a molecular weight of 197.28 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-ethynylcyclohexa-1,3-dien-1-yl)-2-methyl-3,4-dihydropyridine is sourced from PubChem (CID 90691242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).