C20H28N4S2 — CID 90691481
[8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane (PubChem CID 90691481) has the molecular formula C20H28N4S2 and a molecular weight of 388.61 g/mol. Its IUPAC name is [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane.
| Compound Name | [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane |
|---|---|
| PubChem CID | 90691481 |
| Molecular Formula | C20H28N4S2 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane |
| SMILES | CC.CC.[H]/N=C(\N)SCc1cccc2c1=c1c(CS/C(N)=N/[H])cccc1=2 |
| InChI | InChI=1S/C16H16N4S2.2C2H6/c17-15(18)21-7-9-3-1-5-11-12-6-2-4-10(8-22-16(19)20)14(12)13(9)11;2*1-2/h1-6H,7-8H2,(H3,17,18)(H3,19,20);2*1-2H3 |
| InChIKey | KZICDPIFPLZYNB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|