About [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane
[8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane (PubChem CID 90691481) has the molecular formula C20H28N4S2
and a molecular weight of 388.61 g/mol. Its IUPAC name is [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane.
Molecular Properties
| Compound Name | [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane |
| PubChem CID | 90691481 |
| Molecular Formula | C20H28N4S2 |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane |
| SMILES | CC.CC.[H]/N=C(\N)SCc1cccc2c1=c1c(CS/C(N)=N/[H])cccc1=2 |
| InChI | InChI=1S/C16H16N4S2.2C2H6/c17-15(18)21-7-9-3-1-5-11-12-6-2-4-10(8-22-16(19)20)14(12)13(9)11;2*1-2/h1-6H,7-8H2,(H3,17,18)(H3,19,20);2*1-2H3 |
| InChIKey | KZICDPIFPLZYNB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane?
The IUPAC name of [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane (CID 90691481) is [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane.
What is the SMILES notation for [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane?
The canonical SMILES for [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane is CC.CC.[H]/N=C(\N)SCc1cccc2c1=c1c(CS/C(N)=N/[H])cccc1=2.
What is the InChIKey of [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane?
The InChIKey is KZICDPIFPLZYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4S2.2C2H6/c17-15(18)21-7-9-3-1-5-11-12-6-2-4-10(8-22-16(19)20)14(12)13(9)11;2*1-2/h1-6H,7-8H2,(H3,17,18)(H3,19,20);2*1-2H3.
What are the key properties of [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane?
[8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane has a molecular weight of 388.61 g/mol, XLogP of 4.88, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(carbamimidoylsulfanylmethyl)biphenylen-1-yl]methyl carbamimidothioate;ethane is sourced from PubChem (CID 90691481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).