C28H14N4S4 — CID 90691512
4,5,6-tris(1,3-benzothiazol-2-yl)-1,3-benzothiazole (PubChem CID 90691512) has the molecular formula C28H14N4S4 and a molecular weight of 534.72 g/mol. Its IUPAC name is 4,5,6-tris(1,3-benzothiazol-2-yl)-1,3-benzothiazole.
| Compound Name | 4,5,6-tris(1,3-benzothiazol-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 90691512 |
| Molecular Formula | C28H14N4S4 |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | 4,5,6-tris(1,3-benzothiazol-2-yl)-1,3-benzothiazole |
| SMILES | c1ccc2sc(-c3cc4scnc4c(-c4nc5ccccc5s4)c3-c3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C28H14N4S4/c1-4-10-19-16(7-1)30-26(34-19)15-13-22-25(29-14-33-22)24(28-32-18-9-3-6-12-21(18)36-28)23(15)27-31-17-8-2-5-11-20(17)35-27/h1-14H |
| InChIKey | HHEYYMIYNRGITJ-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |