C28H23FN2O5 — CID 90691684
7-[2-(4-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-4-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 90691684) has the molecular formula C28H23FN2O5 and a molecular weight of 486.50 g/mol. Its IUPAC name is 7-[2-(4-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-4-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | 7-[2-(4-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-4-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 90691684 |
| Molecular Formula | C28H23FN2O5 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 7-[2-(4-fluorophenoxy)ethyl]-2-(4-isocyanonaphthalen-1-yl)-4-methyl-5,6-dihydro-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | [C-]#[N+]c1ccc(-n2c(O)c3c(c2O)C2(C)OC3(CCOc3ccc(F)cc3)CC2O)c2ccccc12 |
| InChI | InChI=1S/C28H23FN2O5/c1-27-22(32)15-28(36-27,13-14-35-17-9-7-16(29)8-10-17)24-23(27)25(33)31(26(24)34)21-12-11-20(30-2)18-5-3-4-6-19(18)21/h3-12,22,32-34H,13-15H2,1H3 |
| InChIKey | QXLSCZDOFRUFOW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|