C20H13FN4O2S — CID 90691742
4-[[[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid (PubChem CID 90691742) has the molecular formula C20H13FN4O2S and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-[[[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid.
| Compound Name | 4-[[[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 90691742 |
| Molecular Formula | C20H13FN4O2S |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-[[[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]diazenyl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C/N=N/c2ncnc3cc(-c4ccc(F)cc4)sc23)cc1 |
| InChI | InChI=1S/C20H13FN4O2S/c21-15-7-5-13(6-8-15)17-9-16-18(28-17)19(23-11-22-16)25-24-10-12-1-3-14(4-2-12)20(26)27/h1-9,11H,10H2,(H,26,27)/b25-24+ |
| InChIKey | FKCPHBPLTOCABO-OCOZRVBESA-N |
| XLogP | 5.48 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|