About 2,3-dimethylpent-2-ene;ethane
2,3-dimethylpent-2-ene;ethane (PubChem CID 90691784) has the molecular formula C9H20
and a molecular weight of 128.26 g/mol. Its IUPAC name is 2,3-dimethylpent-2-ene;ethane.
Molecular Properties
| Compound Name | 2,3-dimethylpent-2-ene;ethane |
| PubChem CID | 90691784 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | 2,3-dimethylpent-2-ene;ethane |
| SMILES | CC.CCC(C)=C(C)C |
| InChI | InChI=1S/C7H14.C2H6/c1-5-7(4)6(2)3;1-2/h5H2,1-4H3;1-2H3 |
| InChIKey | MHTAJSKGHHWLMU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylpent-2-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpent-2-ene;ethane?
The IUPAC name of 2,3-dimethylpent-2-ene;ethane (CID 90691784) is 2,3-dimethylpent-2-ene;ethane.
What is the SMILES notation for 2,3-dimethylpent-2-ene;ethane?
The canonical SMILES for 2,3-dimethylpent-2-ene;ethane is CC.CCC(C)=C(C)C.
What is the InChIKey of 2,3-dimethylpent-2-ene;ethane?
The InChIKey is MHTAJSKGHHWLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C2H6/c1-5-7(4)6(2)3;1-2/h5H2,1-4H3;1-2H3.
What are the key properties of 2,3-dimethylpent-2-ene;ethane?
2,3-dimethylpent-2-ene;ethane has a molecular weight of 128.26 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpent-2-ene;ethane is sourced from PubChem (CID 90691784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).