C28H49N3O8 — CID 90691938
(2,5-dihydroxypyrrol-1-yl) 3-(2,4,4-trimethylhexan-2-ylcarbamoyloxymethyl)-4-(2,4,4-trimethylpentan-2-ylcarbamoyloxy)butanoate (PubChem CID 90691938) has the molecular formula C28H49N3O8 and a molecular weight of 555.71 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-(2,4,4-trimethylhexan-2-ylcarbamoyloxymethyl)-4-(2,4,4-trimethylpentan-2-ylcarbamoyloxy)butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-(2,4,4-trimethylhexan-2-ylcarbamoyloxymethyl)-4-(2,4,4-trimethylpentan-2-ylcarbamoyloxy)butanoate |
|---|---|
| PubChem CID | 90691938 |
| Molecular Formula | C28H49N3O8 |
| Molecular Weight | 555.71 g/mol |
| Exact Mass | 555.35 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-(2,4,4-trimethylhexan-2-ylcarbamoyloxymethyl)-4-(2,4,4-trimethylpentan-2-ylcarbamoyloxy)butanoate |
| SMILES | CCC(C)(C)CC(C)(C)NC(=O)OCC(COC(=O)NC(C)(C)CC(C)(C)C)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C28H49N3O8/c1-11-26(5,6)18-28(9,10)30-24(36)38-16-19(14-22(34)39-31-20(32)12-13-21(31)33)15-37-23(35)29-27(7,8)17-25(2,3)4/h12-13,19,32-33H,11,14-18H2,1-10H3,(H,29,35)(H,30,36) |
| InChIKey | LXNOUDZYYBWGGF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.71 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |