C19H19F3N2OS — CID 90692401
[3-ethyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N-(2-ethenylphenyl)methanimidothioate (PubChem CID 90692401) has the molecular formula C19H19F3N2OS and a molecular weight of 380.44 g/mol. Its IUPAC name is [3-ethyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N-(2-ethenylphenyl)methanimidothioate.
| Compound Name | [3-ethyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N-(2-ethenylphenyl)methanimidothioate |
|---|---|
| PubChem CID | 90692401 |
| Molecular Formula | C19H19F3N2OS |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [3-ethyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl N-(2-ethenylphenyl)methanimidothioate |
| SMILES | C=Cc1ccccc1/N=C/SCc1nccc(OCC(F)(F)F)c1CC |
| InChI | InChI=1S/C19H19F3N2OS/c1-3-14-7-5-6-8-16(14)24-13-26-11-17-15(4-2)18(9-10-23-17)25-12-19(20,21)22/h3,5-10,13H,1,4,11-12H2,2H3/b24-13+ |
| InChIKey | HMHLBWHFDKPSAX-ZMOGYAJESA-N |
| XLogP | 5.82 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|