C15H26O — CID 90692477
(3aS,5R,8S,8aS)-3a,8-dimethyl-5-propan-2-yl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one (PubChem CID 90692477) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (3aS,5R,8S,8aS)-3a,8-dimethyl-5-propan-2-yl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one.
| Compound Name | (3aS,5R,8S,8aS)-3a,8-dimethyl-5-propan-2-yl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one |
|---|---|
| PubChem CID | 90692477 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (3aS,5R,8S,8aS)-3a,8-dimethyl-5-propan-2-yl-2,3,4,5,6,7,8,8a-octahydroazulen-1-one |
| SMILES | CC(C)[C@@H]1CC[C@H](C)[C@@H]2C(=O)CC[C@@]2(C)C1 |
| InChI | InChI=1S/C15H26O/c1-10(2)12-6-5-11(3)14-13(16)7-8-15(14,4)9-12/h10-12,14H,5-9H2,1-4H3/t11-,12+,14+,15-/m0/s1 |
| InChIKey | LEPYHSGINCWLAF-MXYBEHONSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |