C47H57ClN4O5S — CID 90692518
[1-[5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-2-oxo-3H-indol-1-yl]-2-ethoxy-2-oxoethyl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 90692518) has the molecular formula C47H57ClN4O5S and a molecular weight of 825.52 g/mol. Its IUPAC name is [1-[5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-2-oxo-3H-indol-1-yl]-2-ethoxy-2-oxoethyl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [1-[5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-2-oxo-3H-indol-1-yl]-2-ethoxy-2-oxoethyl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 90692518 |
| Molecular Formula | C47H57ClN4O5S |
| Molecular Weight | 825.52 g/mol |
| Exact Mass | 824.37 |
| IUPAC Name | [1-[5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-2-oxo-3H-indol-1-yl]-2-ethoxy-2-oxoethyl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(C(=O)OCC)N1C(=O)Cc2cc(CCN3CCN(c4nsc5ccccc45)CC3)c(Cl)cc21 |
| InChI | InChI=1S/C47H57ClN4O5S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-44(54)57-46(47(55)56-4-2)52-41-36-40(48)37(34-38(41)35-43(52)53)28-29-50-30-32-51(33-31-50)45-39-25-23-24-26-42(39)58-49-45/h5-6,8-9,11-12,14-15,17-18,20-21,23-26,34,36,46H,3-4,7,10,13,16,19,22,27-33,35H2,1-2H3 |
| InChIKey | PISOFZZQWUOTCP-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 92.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.52 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|