C14H17N3O7S — CID 90692563
2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-(2,3,5,6-tetrahydroxy-4-propylphenyl)acetamide (PubChem CID 90692563) has the molecular formula C14H17N3O7S and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-(2,3,5,6-tetrahydroxy-4-propylphenyl)acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-(2,3,5,6-tetrahydroxy-4-propylphenyl)acetamide |
|---|---|
| PubChem CID | 90692563 |
| Molecular Formula | C14H17N3O7S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-(2,3,5,6-tetrahydroxy-4-propylphenyl)acetamide |
| SMILES | CCCc1c(O)c(O)c(NC(=O)C(O)(O)c2csc(N)n2)c(O)c1O |
| InChI | InChI=1S/C14H17N3O7S/c1-2-3-5-8(18)10(20)7(11(21)9(5)19)17-12(22)14(23,24)6-4-25-13(15)16-6/h4,18-21,23-24H,2-3H2,1H3,(H2,15,16)(H,17,22) |
| InChIKey | BQVFGIZNLPLFFW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 189.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|