About CID 90692997
CID 90692997 (PubChem CID 90692997) has the molecular formula C4H11BO2
and a molecular weight of 103.95 g/mol.
Molecular Properties
| Compound Name | CID 90692997 |
| PubChem CID | 90692997 |
| Molecular Formula | C4H11BO2 |
| Molecular Weight | 103.95 g/mol |
| Exact Mass | 104.10 |
| IUPAC Name | — |
| SMILES | C=CCCB(O)O.[2H][2H] |
| InChI | InChI=1S/C4H9BO2.H2/c1-2-3-4-5(6)7;/h2,6-7H,1,3-4H2;1H/i;1+1D |
| InChIKey | XHCHFCHWKBBNQJ-PJFXLBAMSA-N |
| XLogP | 0.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.95 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 90692997 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90692997?
The IUPAC name of CID 90692997 (CID 90692997) is not available.
What is the SMILES notation for CID 90692997?
The canonical SMILES for CID 90692997 is C=CCCB(O)O.[2H][2H].
What is the InChIKey of CID 90692997?
The InChIKey is XHCHFCHWKBBNQJ-PJFXLBAMSA-N. The full InChI is InChI=1S/C4H9BO2.H2/c1-2-3-4-5(6)7;/h2,6-7H,1,3-4H2;1H/i;1+1D.
What are the key properties of CID 90692997?
CID 90692997 has a molecular weight of 103.95 g/mol, XLogP of 0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90692997 is sourced from PubChem (CID 90692997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).