C8H14N2+2 — CID 90694123
1,2,5-trimethyl-3-methylidene-4H-pyrimidine-1,3-diium (PubChem CID 90694123) has the molecular formula C8H14N2+2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,2,5-trimethyl-3-methylidene-4H-pyrimidine-1,3-diium.
| Compound Name | 1,2,5-trimethyl-3-methylidene-4H-pyrimidine-1,3-diium |
|---|---|
| PubChem CID | 90694123 |
| Molecular Formula | C8H14N2+2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.11 |
| IUPAC Name | 1,2,5-trimethyl-3-methylidene-4H-pyrimidine-1,3-diium |
| SMILES | C=[N+]1CC(C)=C[N+](C)=C1C |
| InChI | InChI=1S/C8H14N2/c1-7-5-9(3)8(2)10(4)6-7/h6H,3,5H2,1-2,4H3/q+2 |
| InChIKey | MCBJFNKIXXSPPI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|