C30H55FN8O3 — CID 90694902
6-fluoro-2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 90694902) has the molecular formula C30H55FN8O3 and a molecular weight of 594.82 g/mol. Its IUPAC name is 6-fluoro-2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-fluoro-2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90694902 |
| Molecular Formula | C30H55FN8O3 |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | 6-fluoro-2-N,2-N,4-N-tris(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(F)nc(N(C3CC(C)(C)N(O)C(C)(C)C3)C3CC(C)(C)N(O)C(C)(C)C3)n2)CC(C)(C)N1O |
| InChI | InChI=1S/C30H55FN8O3/c1-25(2)13-19(14-26(3,4)37(25)40)32-23-33-22(31)34-24(35-23)36(20-15-27(5,6)38(41)28(7,8)16-20)21-17-29(9,10)39(42)30(11,12)18-21/h19-21,40-42H,13-18H2,1-12H3,(H,32,33,34,35) |
| InChIKey | DJKASSZAYFELBW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 124.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |