C19H16Cl2F3NO4S — CID 90695121
[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methyl methanesulfonate (PubChem CID 90695121) has the molecular formula C19H16Cl2F3NO4S and a molecular weight of 482.31 g/mol. Its IUPAC name is [4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methyl methanesulfonate.
| Compound Name | [4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 90695121 |
| Molecular Formula | C19H16Cl2F3NO4S |
| Molecular Weight | 482.31 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | [4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methyl methanesulfonate |
| SMILES | Cc1cc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)ccc1COS(C)(=O)=O |
| InChI | InChI=1S/C19H16Cl2F3NO4S/c1-11-5-12(3-4-13(11)10-28-30(2,26)27)17-9-18(29-25-17,19(22,23)24)14-6-15(20)8-16(21)7-14/h3-9,25H,10H2,1-2H3 |
| InChIKey | BREVSIPOUJKQCR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.31 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|