About 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one
1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one (PubChem CID 90695133) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one |
| PubChem CID | 90695133 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one |
| SMILES | CON1C(=O)C2(CCNC2)c2ccccc21 |
| InChI | InChI=1S/C12H14N2O2/c1-16-14-10-5-3-2-4-9(10)12(11(14)15)6-7-13-8-12/h2-5,13H,6-8H2,1H3 |
| InChIKey | TVKCHXPYQJQNNR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one?
The IUPAC name of 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one (CID 90695133) is 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one?
The canonical SMILES for 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one is CON1C(=O)C2(CCNC2)c2ccccc21.
What is the InChIKey of 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one?
The InChIKey is TVKCHXPYQJQNNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-16-14-10-5-3-2-4-9(10)12(11(14)15)6-7-13-8-12/h2-5,13H,6-8H2,1H3.
What are the key properties of 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one?
1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one has a molecular weight of 218.26 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyspiro[indole-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 90695133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).