C26H23ClFNO8S2 — CID 90695278
2-(2-oxooxolan-3-yl)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate (PubChem CID 90695278) has the molecular formula C26H23ClFNO8S2 and a molecular weight of 596.05 g/mol. Its IUPAC name is 2-(2-oxooxolan-3-yl)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate.
| Compound Name | 2-(2-oxooxolan-3-yl)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90695278 |
| Molecular Formula | C26H23ClFNO8S2 |
| Molecular Weight | 596.05 g/mol |
| Exact Mass | 595.05 |
| IUPAC Name | 2-(2-oxooxolan-3-yl)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OCCC1CCOC1=O)S(=O)(=O)c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C26H23ClFNO8S2/c1-14-21(26(31)37-12-10-15-9-11-36-25(15)30)23(22-16(27)5-4-6-17(22)28)24-18(29-14)13-38(32,33)19-7-2-3-8-20(19)39(24,34)35/h2-8,15,21,23H,9-13H2,1H3 |
| InChIKey | IRWMHDCGXBGHED-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 133.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.05 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |