C29H31N7O2 — CID 90695662
1-[[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-3-nitrophenyl]methyl]-4-(3-phenylprop-2-enyl)piperazine (PubChem CID 90695662) has the molecular formula C29H31N7O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 1-[[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-3-nitrophenyl]methyl]-4-(3-phenylprop-2-enyl)piperazine.
| Compound Name | 1-[[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-3-nitrophenyl]methyl]-4-(3-phenylprop-2-enyl)piperazine |
|---|---|
| PubChem CID | 90695662 |
| Molecular Formula | C29H31N7O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 1-[[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]-3-nitrophenyl]methyl]-4-(3-phenylprop-2-enyl)piperazine |
| SMILES | Cc1cccc(C)c1-n1nnnc1-c1c(CN2CCN(CC=Cc3ccccc3)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H31N7O2/c1-22-9-6-10-23(2)28(22)35-29(30-31-32-35)27-25(14-7-15-26(27)36(37)38)21-34-19-17-33(18-20-34)16-8-13-24-11-4-3-5-12-24/h3-15H,16-21H2,1-2H3 |
| InChIKey | AWJDTCWFXKBDEE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|