C18H13Cl2N5OS — CID 90695812
(3-amino-2,6-dichlorophenyl)-[4-amino-2-(1H-indol-5-ylamino)-1,3-thiazol-5-yl]methanone (PubChem CID 90695812) has the molecular formula C18H13Cl2N5OS and a molecular weight of 418.31 g/mol. Its IUPAC name is (3-amino-2,6-dichlorophenyl)-[4-amino-2-(1H-indol-5-ylamino)-1,3-thiazol-5-yl]methanone.
| Compound Name | (3-amino-2,6-dichlorophenyl)-[4-amino-2-(1H-indol-5-ylamino)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 90695812 |
| Molecular Formula | C18H13Cl2N5OS |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | (3-amino-2,6-dichlorophenyl)-[4-amino-2-(1H-indol-5-ylamino)-1,3-thiazol-5-yl]methanone |
| SMILES | Nc1ccc(Cl)c(C(=O)c2sc(Nc3ccc4[nH]ccc4c3)nc2N)c1Cl |
| InChI | InChI=1S/C18H13Cl2N5OS/c19-10-2-3-11(21)14(20)13(10)15(26)16-17(22)25-18(27-16)24-9-1-4-12-8(7-9)5-6-23-12/h1-7,23H,21-22H2,(H,24,25) |
| InChIKey | SCESLRKDXARZJR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|