C21H48N12+2 — CID 90695937
3-[[amino-[[N'-[[[amino-[(N'-butylcarbamimidoyl)amino]methylidene]amino]methyl]carbamimidoyl]amino]methylidene]amino]propyl-dimethyl-[(E)-4-(trimethylazaniumyl)but-2-enyl]azanium (PubChem CID 90695937) has the molecular formula C21H48N12+2 and a molecular weight of 468.70 g/mol. Its IUPAC name is 3-[[amino-[[N'-[[[amino-[(N'-butylcarbamimidoyl)amino]methylidene]amino]methyl]carbamimidoyl]amino]methylidene]amino]propyl-dimethyl-[(E)-4-(trimethylazaniumyl)but-2-enyl]azanium.
| Compound Name | 3-[[amino-[[N'-[[[amino-[(N'-butylcarbamimidoyl)amino]methylidene]amino]methyl]carbamimidoyl]amino]methylidene]amino]propyl-dimethyl-[(E)-4-(trimethylazaniumyl)but-2-enyl]azanium |
|---|---|
| PubChem CID | 90695937 |
| Molecular Formula | C21H48N12+2 |
| Molecular Weight | 468.70 g/mol |
| Exact Mass | 468.41 |
| IUPAC Name | 3-[[amino-[[N'-[[[amino-[(N'-butylcarbamimidoyl)amino]methylidene]amino]methyl]carbamimidoyl]amino]methylidene]amino]propyl-dimethyl-[(E)-4-(trimethylazaniumyl)but-2-enyl]azanium |
| SMILES | CCCC/N=C(\N)NC(N)=NCN=C(N)N/C(N)=N/CCC[N+](C)(C)C/C=C/C[N+](C)(C)C |
| InChI | InChI=1S/C21H48N12/c1-7-8-12-26-18(22)30-20(24)28-17-29-21(25)31-19(23)27-13-11-16-33(5,6)15-10-9-14-32(2,3)4/h9-10H,7-8,11-17H2,1-6H3,(H5,22,24,26,28,30)(H5,23,25,27,29,31)/q+2/b10-9+ |
| InChIKey | RUKOQFILQGJBHG-MDZDMXLPSA-N |
| XLogP | -1.09 |
| TPSA | 177.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.70 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|