C13H17F3 — CID 90695962
2,4-dimethyl-3-(3,3,3-trifluoroprop-1-en-2-yl)octa-1,3,5-triene (PubChem CID 90695962) has the molecular formula C13H17F3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2,4-dimethyl-3-(3,3,3-trifluoroprop-1-en-2-yl)octa-1,3,5-triene.
| Compound Name | 2,4-dimethyl-3-(3,3,3-trifluoroprop-1-en-2-yl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 90695962 |
| Molecular Formula | C13H17F3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2,4-dimethyl-3-(3,3,3-trifluoroprop-1-en-2-yl)octa-1,3,5-triene |
| SMILES | C=C(C)C(C(=C)C(F)(F)F)=C(C)C=CCC |
| InChI | InChI=1S/C13H17F3/c1-6-7-8-10(4)12(9(2)3)11(5)13(14,15)16/h7-8H,2,5-6H2,1,3-4H3 |
| InChIKey | KUAHDXRUUQPGDY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|