C8H13NO — CID 90696139
4a,5,6,7,8,8a-hexahydro-2H-1,3-benzoxazine (PubChem CID 90696139) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 4a,5,6,7,8,8a-hexahydro-2H-1,3-benzoxazine.
| Compound Name | 4a,5,6,7,8,8a-hexahydro-2H-1,3-benzoxazine |
|---|---|
| PubChem CID | 90696139 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4a,5,6,7,8,8a-hexahydro-2H-1,3-benzoxazine |
| SMILES | C1=NCOC2CCCCC12 |
| InChI | InChI=1S/C8H13NO/c1-2-4-8-7(3-1)5-9-6-10-8/h5,7-8H,1-4,6H2 |
| InChIKey | UCBGTDSVSVJSSJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |