C23H28N4O12S — CID 90696494
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide (PubChem CID 90696494) has the molecular formula C23H28N4O12S and a molecular weight of 584.56 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 90696494 |
| Molecular Formula | C23H28N4O12S |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[[2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
| SMILES | COC(CNC(O)(O)Cc1c(O)c(O)c(NC(=O)Cc2csc(N)n2)c(O)c1O)c1c(C)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C23H28N4O12S/c1-7-12(17(32)21(36)20(35)14(7)29)10(39-2)5-25-23(37,38)4-9-15(30)18(33)13(19(34)16(9)31)27-11(28)3-8-6-40-22(24)26-8/h6,10,25,29-38H,3-5H2,1-2H3,(H2,24,26)(H,27,28) |
| InChIKey | WJJYRBRJMNWTRE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 291.57 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|