C13H14N4O12 — CID 90696777
4-amino-3-(7-amino-1,1,4,5,6-pentahydroxy-3-oxoisoindol-2-yl)-3,4,5,5-tetrahydroxypiperidine-2,6-dione (PubChem CID 90696777) has the molecular formula C13H14N4O12 and a molecular weight of 418.27 g/mol. Its IUPAC name is 4-amino-3-(7-amino-1,1,4,5,6-pentahydroxy-3-oxoisoindol-2-yl)-3,4,5,5-tetrahydroxypiperidine-2,6-dione.
| Compound Name | 4-amino-3-(7-amino-1,1,4,5,6-pentahydroxy-3-oxoisoindol-2-yl)-3,4,5,5-tetrahydroxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 90696777 |
| Molecular Formula | C13H14N4O12 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 4-amino-3-(7-amino-1,1,4,5,6-pentahydroxy-3-oxoisoindol-2-yl)-3,4,5,5-tetrahydroxypiperidine-2,6-dione |
| SMILES | Nc1c(O)c(O)c(O)c2c1C(O)(O)N(C1(O)C(=O)NC(=O)C(O)(O)C1(N)O)C2=O |
| InChI | InChI=1S/C13H14N4O12/c14-3-2-1(4(18)6(20)5(3)19)7(21)17(12(2,27)28)10(24)8(22)16-9(23)11(25,26)13(10,15)29/h18-20,24-29H,14-15H2,(H,16,22,23) |
| InChIKey | RERULUBBVOKWEW-UHFFFAOYSA-N |
| XLogP | -6.39 |
| TPSA | 300.59 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | -6.39 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|