C21H24N4O11S — CID 90696893
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-1,1-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide (PubChem CID 90696893) has the molecular formula C21H24N4O11S and a molecular weight of 540.51 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-1,1-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-1,1-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide |
|---|---|
| PubChem CID | 90696893 |
| Molecular Formula | C21H24N4O11S |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[(1,1-dihydroxy-2-phenylethyl)amino]-1,1-dihydroxyethyl]-2,3,5,6-tetrahydroxyphenyl]-2,2-dihydroxyacetamide |
| SMILES | Nc1nc(C(O)(O)C(=O)Nc2c(O)c(O)c(C(O)(O)CNC(O)(O)Cc3ccccc3)c(O)c2O)cs1 |
| InChI | InChI=1S/C21H24N4O11S/c22-18-24-10(7-37-18)21(35,36)17(30)25-12-15(28)13(26)11(14(27)16(12)29)19(31,32)8-23-20(33,34)6-9-4-2-1-3-5-9/h1-5,7,23,26-29,31-36H,6,8H2,(H2,22,24)(H,25,30) |
| InChIKey | MDWNOJJUCHSJLE-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 282.34 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|