C22H20IN4O3S+ — CID 90696974
7-[2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-[2-(2-iodoethynylperoxy)ethyl]-N-methyl-2,1,3-benzoxadiazol-4-amine (PubChem CID 90696974) has the molecular formula C22H20IN4O3S+ and a molecular weight of 547.40 g/mol. Its IUPAC name is 7-[2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-[2-(2-iodoethynylperoxy)ethyl]-N-methyl-2,1,3-benzoxadiazol-4-amine.
| Compound Name | 7-[2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-[2-(2-iodoethynylperoxy)ethyl]-N-methyl-2,1,3-benzoxadiazol-4-amine |
|---|---|
| PubChem CID | 90696974 |
| Molecular Formula | C22H20IN4O3S+ |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | 7-[2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N-[2-(2-iodoethynylperoxy)ethyl]-N-methyl-2,1,3-benzoxadiazol-4-amine |
| SMILES | CC[n+]1c(C=Cc2ccc(N(C)CCOOC#CI)c3nonc23)sc2ccccc21 |
| InChI | InChI=1S/C22H20IN4O3S/c1-3-27-17-6-4-5-7-19(17)31-20(27)11-9-16-8-10-18(22-21(16)24-30-25-22)26(2)13-15-29-28-14-12-23/h4-11H,3,13,15H2,1-2H3/q+1 |
| InChIKey | DZOWOTONWQLLAA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|