C17H16ClNO6 — CID 90697285
2-[(7-chloro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetic acid (PubChem CID 90697285) has the molecular formula C17H16ClNO6 and a molecular weight of 365.77 g/mol. Its IUPAC name is 2-[(7-chloro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetic acid.
| Compound Name | 2-[(7-chloro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 90697285 |
| Molecular Formula | C17H16ClNO6 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[(7-chloro-1,3-dioxospiro[naphthalene-4,4'-oxane]-2-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)c2cc(Cl)ccc2C2(CCOCC2)C1=O |
| InChI | InChI=1S/C17H16ClNO6/c18-9-1-2-11-10(7-9)14(22)13(16(24)19-8-12(20)21)15(23)17(11)3-5-25-6-4-17/h1-2,7,13H,3-6,8H2,(H,19,24)(H,20,21) |
| InChIKey | XMQFHJXDXDNDPT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|