About 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile
2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile (PubChem CID 90697300) has the molecular formula C8H5N3S
and a molecular weight of 175.22 g/mol. Its IUPAC name is 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile |
| PubChem CID | 90697300 |
| Molecular Formula | C8H5N3S |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1cnc(-c2ccc[nH]2)s1 |
| InChI | InChI=1S/C8H5N3S/c9-4-6-5-11-8(12-6)7-2-1-3-10-7/h1-3,5,10H |
| InChIKey | UJZMWSJHCWRSKX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile?
The IUPAC name of 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile (CID 90697300) is 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile.
What is the SMILES notation for 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile?
The canonical SMILES for 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile is N#Cc1cnc(-c2ccc[nH]2)s1.
What is the InChIKey of 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile?
The InChIKey is UJZMWSJHCWRSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S/c9-4-6-5-11-8(12-6)7-2-1-3-10-7/h1-3,5,10H.
What are the key properties of 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile?
2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile has a molecular weight of 175.22 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrol-2-yl)-1,3-thiazole-5-carbonitrile is sourced from PubChem (CID 90697300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).