C16H16Cl3NO3 — CID 90697309
(5,6,8-trichloro-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate (PubChem CID 90697309) has the molecular formula C16H16Cl3NO3 and a molecular weight of 376.67 g/mol. Its IUPAC name is (5,6,8-trichloro-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate.
| Compound Name | (5,6,8-trichloro-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate |
|---|---|
| PubChem CID | 90697309 |
| Molecular Formula | C16H16Cl3NO3 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | (5,6,8-trichloro-1-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl) acetate |
| SMILES | CC(=O)OC1(C(C)C)OCCc2c1[nH]c1c(Cl)cc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C16H16Cl3NO3/c1-7(2)16(23-8(3)21)15-9(4-5-22-16)12-13(19)10(17)6-11(18)14(12)20-15/h6-7,20H,4-5H2,1-3H3 |
| InChIKey | KUVGXTRWFKAVCW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|